C21H30N4O6S — CID 22696185
N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[4-(2-methylpropyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide (PubChem CID 22696185) has the molecular formula C21H30N4O6S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[4-(2-methylpropyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[4-(2-methylpropyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22696185 |
| Molecular Formula | C21H30N4O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[4-(2-methylpropyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1n1nc(COc2ccccc2)n(CC(C)C)c1=S |
| InChI | InChI=1S/C21H30N4O6S/c1-12(2)9-24-16(11-30-14-7-5-4-6-8-14)23-25(21(24)32)20-17(22-13(3)27)19(29)18(28)15(10-26)31-20/h4-8,12,15,17-20,26,28-29H,9-11H2,1-3H3,(H,22,27)/t15-,17-,18-,19-,20-/m1/s1 |
| InChIKey | WXHCYCLZDRODJU-YHUYVZNPSA-N |
| XLogP | 0.77 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|