C25H38N4O6S — CID 22696245
N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(4-tert-butylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 22696245) has the molecular formula C25H38N4O6S and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(4-tert-butylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(4-tert-butylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22696245 |
| Molecular Formula | C25H38N4O6S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(4-tert-butylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CCC(C)n1c(COc2ccc(C(C)(C)C)cc2)nn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)c1=S |
| InChI | InChI=1S/C25H38N4O6S/c1-7-14(2)28-19(13-34-17-10-8-16(9-11-17)25(4,5)6)27-29(24(28)36)23-20(26-15(3)31)22(33)21(32)18(12-30)35-23/h8-11,14,18,20-23,30,32-33H,7,12-13H2,1-6H3,(H,26,31)/t14?,18-,20-,21-,22-,23-/m1/s1 |
| InChIKey | XHUGMXAZXWXQGY-JIJGLVORSA-N |
| XLogP | 2.38 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|