C20H26ClFN4O5S — CID 22696183
N-[(2R,3R,4R,5S,6R)-2-[3-(3-chloro-4-fluorophenyl)-4-(2-methylpropyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 22696183) has the molecular formula C20H26ClFN4O5S and a molecular weight of 488.97 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[3-(3-chloro-4-fluorophenyl)-4-(2-methylpropyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[3-(3-chloro-4-fluorophenyl)-4-(2-methylpropyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22696183 |
| Molecular Formula | C20H26ClFN4O5S |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[3-(3-chloro-4-fluorophenyl)-4-(2-methylpropyl)-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1n1nc(-c2ccc(F)c(Cl)c2)n(CC(C)C)c1=S |
| InChI | InChI=1S/C20H26ClFN4O5S/c1-9(2)7-25-18(11-4-5-13(22)12(21)6-11)24-26(20(25)32)19-15(23-10(3)28)17(30)16(29)14(8-27)31-19/h4-6,9,14-17,19,27,29-30H,7-8H2,1-3H3,(H,23,28)/t14-,15-,16-,17-,19-/m1/s1 |
| InChIKey | HLLMQIJXLDUIEJ-VYIWNADRSA-N |
| XLogP | 1.65 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|