C21H30N4O5S — CID 71949862
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-pentyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)oxan-3-yl]acetamide (PubChem CID 71949862) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-pentyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)oxan-3-yl]acetamide.
| Compound Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-pentyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 71949862 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-pentyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)oxan-3-yl]acetamide |
| SMILES | CCCCCn1c(-c2ccccc2)nn(C2OC(CO)C(O)C(O)C2NC(C)=O)c1=S |
| InChI | InChI=1S/C21H30N4O5S/c1-3-4-8-11-24-19(14-9-6-5-7-10-14)23-25(21(24)31)20-16(22-13(2)27)18(29)17(28)15(12-26)30-20/h5-7,9-10,15-18,20,26,28-29H,3-4,8,11-12H2,1-2H3,(H,22,27) |
| InChIKey | HIPCFDOXSJAFBS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|