C18H23ClN4O6S — CID 22696145
N-[(2R,3R,4R,5S,6R)-2-[3-[(2-chlorophenoxy)methyl]-4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 22696145) has the molecular formula C18H23ClN4O6S and a molecular weight of 458.92 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[3-[(2-chlorophenoxy)methyl]-4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[3-[(2-chlorophenoxy)methyl]-4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22696145 |
| Molecular Formula | C18H23ClN4O6S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[3-[(2-chlorophenoxy)methyl]-4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1n1nc(COc2ccccc2Cl)n(C)c1=S |
| InChI | InChI=1S/C18H23ClN4O6S/c1-9(25)20-14-16(27)15(26)12(7-24)29-17(14)23-18(30)22(2)13(21-23)8-28-11-6-4-3-5-10(11)19/h3-6,12,14-17,24,26-27H,7-8H2,1-2H3,(H,20,25)/t12-,14-,15-,16-,17-/m1/s1 |
| InChIKey | TWTSFJCWLVYBDV-LMHBHQSJSA-N |
| XLogP | 0.30 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|