C22H32N4O6S — CID 22696239
N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(2-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 22696239) has the molecular formula C22H32N4O6S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(2-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(2-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22696239 |
| Molecular Formula | C22H32N4O6S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[4-butan-2-yl-3-[(2-methylphenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CCC(C)n1c(COc2ccccc2C)nn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)c1=S |
| InChI | InChI=1S/C22H32N4O6S/c1-5-13(3)25-17(11-31-15-9-7-6-8-12(15)2)24-26(22(25)33)21-18(23-14(4)28)20(30)19(29)16(10-27)32-21/h6-9,13,16,18-21,27,29-30H,5,10-11H2,1-4H3,(H,23,28)/t13?,16-,18-,19-,20-,21-/m1/s1 |
| InChIKey | PMCQXSRGCPFZNN-SLOQVBGBSA-N |
| XLogP | 1.39 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|