C23H32N4O7S — CID 22696261
N-[(2R,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 22696261) has the molecular formula C23H32N4O7S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22696261 |
| Molecular Formula | C23H32N4O7S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfanylidene-1,2,4-triazol-1-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | COc1ccc(CCc2nn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3NC(C)=O)c(=S)n2C2CC2)cc1OC |
| InChI | InChI=1S/C23H32N4O7S/c1-12(29)24-19-21(31)20(30)17(11-28)34-22(19)27-23(35)26(14-6-7-14)18(25-27)9-5-13-4-8-15(32-2)16(10-13)33-3/h4,8,10,14,17,19-22,28,30-31H,5-7,9,11H2,1-3H3,(H,24,29)/t17-,19-,20-,21-,22-/m1/s1 |
| InChIKey | QSMTXNBXHQJCDV-MSEOUXRUSA-N |
| XLogP | 0.67 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|