C16H19NO6 — CID 174773100
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-phenylpyrrol-2-yl)oxyoxane-3,4,5-triol (PubChem CID 174773100) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-phenylpyrrol-2-yl)oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-phenylpyrrol-2-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 174773100 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-phenylpyrrol-2-yl)oxyoxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccn2-c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19NO6/c18-9-11-13(19)14(20)15(21)16(22-11)23-12-7-4-8-17(12)10-5-2-1-3-6-10/h1-8,11,13-16,18-21H,9H2/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | YVPFQWYDXHGDNE-JZYAIQKZSA-N |
| XLogP | -0.34 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |