C11H19N3O4 — CID 10801133
(2S,3R,4S,5R)-2-(1,5-diethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10801133) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(1,5-diethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(1,5-diethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10801133 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2S,3R,4S,5R)-2-(1,5-diethyl-1,2,4-triazol-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCc1nc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)nn1CC |
| InChI | InChI=1S/C11H19N3O4/c1-3-7-12-11(13-14(7)4-2)10-9(17)8(16)6(5-15)18-10/h6,8-10,15-17H,3-5H2,1-2H3/t6-,8-,9-,10-/m1/s1 |
| InChIKey | LPKFKDCTHUWFAZ-PEBGCTIMSA-N |
| XLogP | -0.99 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |