C21H22F5NO5 — CID 89261040
(2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89261040) has the molecular formula C21H22F5NO5 and a molecular weight of 463.40 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89261040 |
| Molecular Formula | C21H22F5NO5 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F5NO5/c22-20(23,21(24,25)26)13-4-1-10(2-5-13)7-12-8-11(3-6-14(12)27)19-18(31)17(30)16(29)15(9-28)32-19/h1-6,8,15-19,28-31H,7,9,27H2/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | XMUAODQHNBALSM-FQBWVUSXSA-N |
| XLogP | 2.03 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|