C20H32O6 — CID 22859364
(2R,3S,4R,5R)-2-(hydroxymethyl)-6-(2-octoxyphenyl)oxane-3,4,5-triol (PubChem CID 22859364) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-6-(2-octoxyphenyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-6-(2-octoxyphenyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 22859364 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-6-(2-octoxyphenyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCCOc1ccccc1C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H32O6/c1-2-3-4-5-6-9-12-25-15-11-8-7-10-14(15)20-19(24)18(23)17(22)16(13-21)26-20/h7-8,10-11,16-24H,2-6,9,12-13H2,1H3/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | SOBDNUJBCRVVGX-QUIYGKKVSA-N |
| XLogP | 1.94 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|