C19H30O5 — CID 22859336
(3R,4R,5S,6R)-2-(2-heptylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 22859336) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-(2-heptylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-(2-heptylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 22859336 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (3R,4R,5S,6R)-2-(2-heptylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCc1ccccc1C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30O5/c1-2-3-4-5-6-9-13-10-7-8-11-14(13)19-18(23)17(22)16(21)15(12-20)24-19/h7-8,10-11,15-23H,2-6,9,12H2,1H3/t15-,16-,17+,18-,19?/m1/s1 |
| InChIKey | ATXKXMOSVVRZNP-DQROZCCUSA-N |
| XLogP | 1.71 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|