C13H15N3O6 — CID 176753109
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol (PubChem CID 176753109) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 176753109 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2nnc(-c3ccccn3)o2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H15N3O6/c17-5-7-8(18)9(19)10(20)11(21-7)13-16-15-12(22-13)6-3-1-2-4-14-6/h1-4,7-11,17-20H,5H2/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | TYMGENKDZAXGSL-ZKKRXERASA-N |
| XLogP | -1.35 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |