C13H16ClN3O5Ru — CID 176753116
carbanide;chlororuthenium(1+);(2R,4S,5R)-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol (PubChem CID 176753116) has the molecular formula C13H16ClN3O5Ru and a molecular weight of 430.81 g/mol. Its IUPAC name is carbanide;chlororuthenium(1+);(2R,4S,5R)-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol.
| Compound Name | carbanide;chlororuthenium(1+);(2R,4S,5R)-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 176753116 |
| Molecular Formula | C13H16ClN3O5Ru |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | carbanide;chlororuthenium(1+);(2R,4S,5R)-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol |
| SMILES | Cl[Ru+].OC1[C@@H](O)[C@H](O)CO[C@H]1c1nnc(-c2ccccn2)o1.[CH3-] |
| InChI | InChI=1S/C12H13N3O5.CH3.ClH.Ru/c16-7-5-19-10(9(18)8(7)17)12-15-14-11(20-12)6-3-1-2-4-13-6;;;/h1-4,7-10,16-18H,5H2;1H3;1H;/q;-1;;+2/p-1/t7-,8+,9?,10-;;;/m1.../s1 |
| InChIKey | DLZJWZZWVWOLOL-BRUUNVHZSA-M |
| XLogP | 0.42 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|