C11H15NO4S — CID 6932553
(1R,2S,3S)-1-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]butane-1,2,3,4-tetrol (PubChem CID 6932553) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is (1R,2S,3S)-1-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]butane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S)-1-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 6932553 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (1R,2S,3S)-1-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]butane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)[C@H]1Nc2ccccc2S1 |
| InChI | InChI=1S/C11H15NO4S/c13-5-7(14)9(15)10(16)11-12-6-3-1-2-4-8(6)17-11/h1-4,7,9-16H,5H2/t7-,9-,10+,11-/m0/s1 |
| InChIKey | VHTKFXGLDKMKTA-BBHBSTQDSA-N |
| XLogP | -0.39 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |