2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid

C9H9NO2S — CID 154116351

IUPAC2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid
SMILESO=C(O)CC1Nc2ccccc2S1
InChIInChI=1S/C9H9NO2S/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12)
InChIKeyJINZMWJGUYFKFB-UHFFFAOYSA-N
MW195.24 g/mol
LogP2.01
Rot. Bonds2

About 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid

2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid (PubChem CID 154116351) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid
PubChem CID154116351
Molecular FormulaC9H9NO2S
Molecular Weight195.24 g/mol
Exact Mass195.04
IUPAC Name2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid
SMILESO=C(O)CC1Nc2ccccc2S1
InChIInChI=1S/C9H9NO2S/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12)
InChIKeyJINZMWJGUYFKFB-UHFFFAOYSA-N
XLogP2.01
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.24
LogP ≤ 52.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid?
The IUPAC name of 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid (CID 154116351) is 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid.
What is the SMILES notation for 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid?
The canonical SMILES for 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid is O=C(O)CC1Nc2ccccc2S1.
What is the InChIKey of 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid?
The InChIKey is JINZMWJGUYFKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12).
What are the key properties of 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid?
2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid has a molecular weight of 195.24 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid is sourced from PubChem (CID 154116351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).