C9H9NO2S — CID 154116351
2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid (PubChem CID 154116351) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid.
| Compound Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 154116351 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)acetic acid |
| SMILES | O=C(O)CC1Nc2ccccc2S1 |
| InChI | InChI=1S/C9H9NO2S/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12) |
| InChIKey | JINZMWJGUYFKFB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |