C12H15NO4S — CID 152760961
(2R,3R,4S,4aS,10aR)-2-(hydroxymethyl)-2,3,4,4a,10,10a-hexahydropyrano[3,2-b][1,4]benzothiazine-3,4-diol (PubChem CID 152760961) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (2R,3R,4S,4aS,10aR)-2-(hydroxymethyl)-2,3,4,4a,10,10a-hexahydropyrano[3,2-b][1,4]benzothiazine-3,4-diol.
| Compound Name | (2R,3R,4S,4aS,10aR)-2-(hydroxymethyl)-2,3,4,4a,10,10a-hexahydropyrano[3,2-b][1,4]benzothiazine-3,4-diol |
|---|---|
| PubChem CID | 152760961 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (2R,3R,4S,4aS,10aR)-2-(hydroxymethyl)-2,3,4,4a,10,10a-hexahydropyrano[3,2-b][1,4]benzothiazine-3,4-diol |
| SMILES | OC[C@H]1O[C@H]2Nc3ccccc3S[C@H]2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15NO4S/c14-5-7-9(15)10(16)11-12(17-7)13-6-3-1-2-4-8(6)18-11/h1-4,7,9-16H,5H2/t7-,9+,10+,11+,12-/m1/s1 |
| InChIKey | LAMZCTGXVVJUPV-GQCVWLSPSA-N |
| XLogP | 0.01 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |