C18H19NO6S — CID 100991641
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenothiazin-10-yloxyoxane-3,4,5-triol (PubChem CID 100991641) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenothiazin-10-yloxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenothiazin-10-yloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 100991641 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenothiazin-10-yloxyoxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](ON2c3ccccc3Sc3ccccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19NO6S/c20-9-12-15(21)16(22)17(23)18(24-12)25-19-10-5-1-3-7-13(10)26-14-8-4-2-6-11(14)19/h1-8,12,15-18,20-23H,9H2/t12-,15-,16+,17-,18+/m1/s1 |
| InChIKey | IMUYAKNLRSCTFA-CUWKQTPXSA-N |
| XLogP | 1.02 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |