C14H17NO6 — CID 20631341
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-indol-1-yloxyoxane-3,4,5-triol (PubChem CID 20631341) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-indol-1-yloxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-indol-1-yloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 20631341 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-indol-1-yloxyoxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(On2ccc3ccccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H17NO6/c16-7-10-11(17)12(18)13(19)14(20-10)21-15-6-5-8-3-1-2-4-9(8)15/h1-6,10-14,16-19H,7H2/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | YHMPTAAOOIERMM-RQICVUQASA-N |
| XLogP | -1.13 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |