C9H11NOS — CID 19697816
3,4-dihydro-2H-1,4-benzothiazin-2-ylmethanol (PubChem CID 19697816) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzothiazin-2-ylmethanol.
| Compound Name | 3,4-dihydro-2H-1,4-benzothiazin-2-ylmethanol |
|---|---|
| PubChem CID | 19697816 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzothiazin-2-ylmethanol |
| SMILES | OCC1CNc2ccccc2S1 |
| InChI | InChI=1S/C9H11NOS/c11-6-7-5-10-8-3-1-2-4-9(8)12-7/h1-4,7,10-11H,5-6H2 |
| InChIKey | KEBRFYLFLLNMBB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |