C13H9FN2O2S — CID 70375535
2-(5-fluoro-2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole (PubChem CID 70375535) has the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole.
| Compound Name | 2-(5-fluoro-2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 70375535 |
| Molecular Formula | C13H9FN2O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(F)cc1C1Nc2ccccc2S1 |
| InChI | InChI=1S/C13H9FN2O2S/c14-8-5-6-11(16(17)18)9(7-8)13-15-10-3-1-2-4-12(10)19-13/h1-7,13,15H |
| InChIKey | SXOXLQLOWCVNLF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|