C29H21N3S — CID 145202412
2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,3-dihydro-1,3-benzothiazole (PubChem CID 145202412) has the molecular formula C29H21N3S and a molecular weight of 443.58 g/mol. Its IUPAC name is 2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,3-dihydro-1,3-benzothiazole.
| Compound Name | 2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 145202412 |
| Molecular Formula | C29H21N3S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,3-dihydro-1,3-benzothiazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc(C4Nc5ccccc5S4)c3)n2)cc1 |
| InChI | InChI=1S/C29H21N3S/c1-3-10-20(11-4-1)25-19-26(21-12-5-2-6-13-21)31-28(30-25)22-14-9-15-23(18-22)29-32-24-16-7-8-17-27(24)33-29/h1-19,29,32H |
| InChIKey | AZBGRUNKRHTBAD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |