About 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine
1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine (PubChem CID 79223158) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine |
| PubChem CID | 79223158 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine |
| SMILES | NC1(CC2Cc3ccccc3S2)CC1 |
| InChI | InChI=1S/C12H15NS/c13-12(5-6-12)8-10-7-9-3-1-2-4-11(9)14-10/h1-4,10H,5-8,13H2 |
| InChIKey | QSQIIUBHZKVIHX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine?
The IUPAC name of 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine (CID 79223158) is 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine.
What is the SMILES notation for 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine?
The canonical SMILES for 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine is NC1(CC2Cc3ccccc3S2)CC1.
What is the InChIKey of 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine?
The InChIKey is QSQIIUBHZKVIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c13-12(5-6-12)8-10-7-9-3-1-2-4-11(9)14-10/h1-4,10H,5-8,13H2.
What are the key properties of 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine?
1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine has a molecular weight of 205.33 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclopropan-1-amine is sourced from PubChem (CID 79223158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).