C15H19ClOS — CID 79224281
4-(chloromethyl)-4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)oxane (PubChem CID 79224281) has the molecular formula C15H19ClOS and a molecular weight of 282.84 g/mol. Its IUPAC name is 4-(chloromethyl)-4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)oxane.
| Compound Name | 4-(chloromethyl)-4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)oxane |
|---|---|
| PubChem CID | 79224281 |
| Molecular Formula | C15H19ClOS |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(chloromethyl)-4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)oxane |
| SMILES | ClCC1(CC2Cc3ccccc3S2)CCOCC1 |
| InChI | InChI=1S/C15H19ClOS/c16-11-15(5-7-17-8-6-15)10-13-9-12-3-1-2-4-14(12)18-13/h1-4,13H,5-11H2 |
| InChIKey | KBQAKJBXDMVTJF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|