C14H19ClS — CID 79224178
2-[2-(chloromethyl)pentyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79224178) has the molecular formula C14H19ClS and a molecular weight of 254.83 g/mol. Its IUPAC name is 2-[2-(chloromethyl)pentyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-[2-(chloromethyl)pentyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79224178 |
| Molecular Formula | C14H19ClS |
| Molecular Weight | 254.83 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[2-(chloromethyl)pentyl]-2,3-dihydro-1-benzothiophene |
| SMILES | CCCC(CCl)CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H19ClS/c1-2-5-11(10-15)8-13-9-12-6-3-4-7-14(12)16-13/h3-4,6-7,11,13H,2,5,8-10H2,1H3 |
| InChIKey | AAZZWTJWQHCDII-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|