C19H21ClS — CID 79206469
2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79206469) has the molecular formula C19H21ClS and a molecular weight of 316.90 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79206469 |
| Molecular Formula | C19H21ClS |
| Molecular Weight | 316.90 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-2,3-dihydro-1-benzothiophene |
| SMILES | Cc1cccc(CC(CCl)CC2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C19H21ClS/c1-14-5-4-6-15(9-14)10-16(13-20)11-18-12-17-7-2-3-8-19(17)21-18/h2-9,16,18H,10-13H2,1H3 |
| InChIKey | CZULRWVLZQCPNP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|