C19H27ClO — CID 102902116
2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-1-oxaspiro[4.4]nonane (PubChem CID 102902116) has the molecular formula C19H27ClO and a molecular weight of 306.88 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-1-oxaspiro[4.4]nonane.
| Compound Name | 2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-1-oxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 102902116 |
| Molecular Formula | C19H27ClO |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[2-(chloromethyl)-3-(3-methylphenyl)propyl]-1-oxaspiro[4.4]nonane |
| SMILES | Cc1cccc(CC(CCl)CC2CCC3(CCCC3)O2)c1 |
| InChI | InChI=1S/C19H27ClO/c1-15-5-4-6-16(11-15)12-17(14-20)13-18-7-10-19(21-18)8-2-3-9-19/h4-6,11,17-18H,2-3,7-10,12-14H2,1H3 |
| InChIKey | ZXCDBKKRMPKCQE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|