C16H22BrClO — CID 116525232
5-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,2-dimethyloxolane (PubChem CID 116525232) has the molecular formula C16H22BrClO and a molecular weight of 345.71 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,2-dimethyloxolane.
| Compound Name | 5-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525232 |
| Molecular Formula | C16H22BrClO |
| Molecular Weight | 345.71 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 5-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(CC(CBr)Cc2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C16H22BrClO/c1-16(2)7-6-15(19-16)10-13(11-17)8-12-4-3-5-14(18)9-12/h3-5,9,13,15H,6-8,10-11H2,1-2H3 |
| InChIKey | QAABUHFQMJAEJN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.71 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|