C15H22BrNO — CID 116524948
1-(4-bromophenyl)-3-(5,5-dimethyloxolan-2-yl)propan-2-amine (PubChem CID 116524948) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(5,5-dimethyloxolan-2-yl)propan-2-amine.
| Compound Name | 1-(4-bromophenyl)-3-(5,5-dimethyloxolan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 116524948 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-(4-bromophenyl)-3-(5,5-dimethyloxolan-2-yl)propan-2-amine |
| SMILES | CC1(C)CCC(CC(N)Cc2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C15H22BrNO/c1-15(2)8-7-14(18-15)10-13(17)9-11-3-5-12(16)6-4-11/h3-6,13-14H,7-10,17H2,1-2H3 |
| InChIKey | GOXRHIBYTMXRNB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |