C17H16ClFS — CID 79438075
2-[3-chloro-2-(4-fluorophenyl)propyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79438075) has the molecular formula C17H16ClFS and a molecular weight of 306.83 g/mol. Its IUPAC name is 2-[3-chloro-2-(4-fluorophenyl)propyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-[3-chloro-2-(4-fluorophenyl)propyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79438075 |
| Molecular Formula | C17H16ClFS |
| Molecular Weight | 306.83 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-[3-chloro-2-(4-fluorophenyl)propyl]-2,3-dihydro-1-benzothiophene |
| SMILES | Fc1ccc(C(CCl)CC2Cc3ccccc3S2)cc1 |
| InChI | InChI=1S/C17H16ClFS/c18-11-14(12-5-7-15(19)8-6-12)10-16-9-13-3-1-2-4-17(13)20-16/h1-8,14,16H,9-11H2 |
| InChIKey | ZGUKESLMYHLAEF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|