C18H19N3O2S — CID 167797332
4-[[(1S,2R)-1-methoxy-2,3-dihydro-1H-inden-2-yl]carbamothioylamino]benzamide (PubChem CID 167797332) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[[(1S,2R)-1-methoxy-2,3-dihydro-1H-inden-2-yl]carbamothioylamino]benzamide.
| Compound Name | 4-[[(1S,2R)-1-methoxy-2,3-dihydro-1H-inden-2-yl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 167797332 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[[(1S,2R)-1-methoxy-2,3-dihydro-1H-inden-2-yl]carbamothioylamino]benzamide |
| SMILES | CO[C@H]1c2ccccc2C[C@H]1NC(=S)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-23-16-14-5-3-2-4-12(14)10-15(16)21-18(24)20-13-8-6-11(7-9-13)17(19)22/h2-9,15-16H,10H2,1H3,(H2,19,22)(H2,20,21,24)/t15-,16+/m1/s1 |
| InChIKey | FITXKWOOLSTSGM-CVEARBPZSA-N |
| XLogP | 2.38 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|