C24H27NO5 — CID 177338456
[2-[[(2S)-1-[(1-methyl-2,3-dihydro-1H-inden-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]phenyl] butanoate (PubChem CID 177338456) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [2-[[(2S)-1-[(1-methyl-2,3-dihydro-1H-inden-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]phenyl] butanoate.
| Compound Name | [2-[[(2S)-1-[(1-methyl-2,3-dihydro-1H-inden-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]phenyl] butanoate |
|---|---|
| PubChem CID | 177338456 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-[[(2S)-1-[(1-methyl-2,3-dihydro-1H-inden-2-yl)oxy]-1-oxopropan-2-yl]carbamoyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccccc1C(=O)N[C@@H](C)C(=O)OC1Cc2ccccc2C1C |
| InChI | InChI=1S/C24H27NO5/c1-4-9-22(26)29-20-13-8-7-12-19(20)23(27)25-16(3)24(28)30-21-14-17-10-5-6-11-18(17)15(21)2/h5-8,10-13,15-16,21H,4,9,14H2,1-3H3,(H,25,27)/t15?,16-,21?/m0/s1 |
| InChIKey | CFNQBNKCEBLMOA-TZQQIIETSA-N |
| XLogP | 3.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|