C13H17BrOSi — CID 10565906
[(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl]oxy-ethenyl-dimethylsilane (PubChem CID 10565906) has the molecular formula C13H17BrOSi and a molecular weight of 297.27 g/mol. Its IUPAC name is [(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl]oxy-ethenyl-dimethylsilane.
| Compound Name | [(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl]oxy-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 10565906 |
| Molecular Formula | C13H17BrOSi |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | [(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl]oxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[C@@H]1c2ccccc2C[C@H]1Br |
| InChI | InChI=1S/C13H17BrOSi/c1-4-16(2,3)15-13-11-8-6-5-7-10(11)9-12(13)14/h4-8,12-13H,1,9H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | KJCKTHBQVMOGPG-CHWSQXEVSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|