C16H23IOSi2 — CID 12068182
[(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy-dimethyl-(2-trimethylsilylethynyl)silane (PubChem CID 12068182) has the molecular formula C16H23IOSi2 and a molecular weight of 414.44 g/mol. Its IUPAC name is [(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy-dimethyl-(2-trimethylsilylethynyl)silane.
| Compound Name | [(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy-dimethyl-(2-trimethylsilylethynyl)silane |
|---|---|
| PubChem CID | 12068182 |
| Molecular Formula | C16H23IOSi2 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | [(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy-dimethyl-(2-trimethylsilylethynyl)silane |
| SMILES | C[Si](C)(C)C#C[Si](C)(C)O[C@H]1c2ccccc2C[C@@H]1I |
| InChI | InChI=1S/C16H23IOSi2/c1-19(2,3)10-11-20(4,5)18-16-14-9-7-6-8-13(14)12-15(16)17/h6-9,15-16H,12H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | QBZAHDOFOLDYRR-HOTGVXAUSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|