C13H15IOSi — CID 12068185
ethynyl-[[(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane (PubChem CID 12068185) has the molecular formula C13H15IOSi and a molecular weight of 342.25 g/mol. Its IUPAC name is ethynyl-[[(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane.
| Compound Name | ethynyl-[[(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 12068185 |
| Molecular Formula | C13H15IOSi |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | ethynyl-[[(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane |
| SMILES | C#C[Si](C)(C)O[C@H]1c2ccccc2C[C@@H]1I |
| InChI | InChI=1S/C13H15IOSi/c1-4-16(2,3)15-13-11-8-6-5-7-10(11)9-12(13)14/h1,5-8,12-13H,9H2,2-3H3/t12-,13-/m0/s1 |
| InChIKey | IZWAMCUFCRDWPF-STQMWFEESA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|