C12H15IO — CID 101064195
(1R,2R)-2-iodo-1-propan-2-yloxy-2,3-dihydro-1H-indene (PubChem CID 101064195) has the molecular formula C12H15IO and a molecular weight of 302.16 g/mol. Its IUPAC name is (1R,2R)-2-iodo-1-propan-2-yloxy-2,3-dihydro-1H-indene.
| Compound Name | (1R,2R)-2-iodo-1-propan-2-yloxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 101064195 |
| Molecular Formula | C12H15IO |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (1R,2R)-2-iodo-1-propan-2-yloxy-2,3-dihydro-1H-indene |
| SMILES | CC(C)O[C@@H]1c2ccccc2C[C@H]1I |
| InChI | InChI=1S/C12H15IO/c1-8(2)14-12-10-6-4-3-5-9(10)7-11(12)13/h3-6,8,11-12H,7H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | MKRBQXHWZGTEIS-VXGBXAGGSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|