C14H20O — CID 71027765
(1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene (PubChem CID 71027765) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene.
| Compound Name | (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 71027765 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene |
| SMILES | CO[C@@H]1c2ccccc2C[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C14H20O/c1-14(2,3)12-9-10-7-5-6-8-11(10)13(12)15-4/h5-8,12-13H,9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | AUURDTWRLTYZEV-QWHCGFSZSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |