About (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene
(1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene (PubChem CID 71027765) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene |
| PubChem CID | 71027765 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene |
| SMILES | CO[C@@H]1c2ccccc2C[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C14H20O/c1-14(2,3)12-9-10-7-5-6-8-11(10)13(12)15-4/h5-8,12-13H,9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | AUURDTWRLTYZEV-QWHCGFSZSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene?
The IUPAC name of (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene (CID 71027765) is (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene.
What is the SMILES notation for (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene?
The canonical SMILES for (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene is CO[C@@H]1c2ccccc2C[C@@H]1C(C)(C)C.
What is the InChIKey of (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene?
The InChIKey is AUURDTWRLTYZEV-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H20O/c1-14(2,3)12-9-10-7-5-6-8-11(10)13(12)15-4/h5-8,12-13H,9H2,1-4H3/t12-,13+/m0/s1.
What are the key properties of (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene?
(1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene has a molecular weight of 204.31 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-2-tert-butyl-1-methoxy-2,3-dihydro-1H-indene is sourced from PubChem (CID 71027765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).