C10H12O4 — CID 10420198
4-methoxy-4,5-dihydro-1H-2,3-benzodioxepin-1-ol (PubChem CID 10420198) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 4-methoxy-4,5-dihydro-1H-2,3-benzodioxepin-1-ol.
| Compound Name | 4-methoxy-4,5-dihydro-1H-2,3-benzodioxepin-1-ol |
|---|---|
| PubChem CID | 10420198 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-methoxy-4,5-dihydro-1H-2,3-benzodioxepin-1-ol |
| SMILES | COC1Cc2ccccc2C(O)OO1 |
| InChI | InChI=1S/C10H12O4/c1-12-9-6-7-4-2-3-5-8(7)10(11)14-13-9/h2-5,9-11H,6H2,1H3 |
| InChIKey | SNXJNCCBTQRNKE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|