C26H31NO5 — CID 157305579
[2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate (PubChem CID 157305579) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate.
| Compound Name | [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate |
|---|---|
| PubChem CID | 157305579 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1c2ccccc2CC1CC(=O)c1cccc(NC=O)c1O |
| InChI | InChI=1S/C26H31NO5/c1-2-3-4-5-6-14-24(30)32-26-19(15-18-10-7-8-11-20(18)26)16-23(29)21-12-9-13-22(25(21)31)27-17-28/h7-13,17,19,26,31H,2-6,14-16H2,1H3,(H,27,28) |
| InChIKey | BCKRLOUFQIZAHD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|