About [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate
[2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate (PubChem CID 157305579) has the molecular formula C26H31NO5
and a molecular weight of 437.54 g/mol. Its IUPAC name is [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate.
Molecular Properties
| Compound Name | [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate |
| PubChem CID | 157305579 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1c2ccccc2CC1CC(=O)c1cccc(NC=O)c1O |
| InChI | InChI=1S/C26H31NO5/c1-2-3-4-5-6-14-24(30)32-26-19(15-18-10-7-8-11-20(18)26)16-23(29)21-12-9-13-22(25(21)31)27-17-28/h7-13,17,19,26,31H,2-6,14-16H2,1H3,(H,27,28) |
| InChIKey | BCKRLOUFQIZAHD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate?
The IUPAC name of [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate (CID 157305579) is [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate.
What is the SMILES notation for [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate?
The canonical SMILES for [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate is CCCCCCCC(=O)OC1c2ccccc2CC1CC(=O)c1cccc(NC=O)c1O.
What is the InChIKey of [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate?
The InChIKey is BCKRLOUFQIZAHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO5/c1-2-3-4-5-6-14-24(30)32-26-19(15-18-10-7-8-11-20(18)26)16-23(29)21-12-9-13-22(25(21)31)27-17-28/h7-13,17,19,26,31H,2-6,14-16H2,1H3,(H,27,28).
What are the key properties of [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate?
[2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate has a molecular weight of 437.54 g/mol, XLogP of 5.35, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3-formamido-2-hydroxyphenyl)-2-oxoethyl]-2,3-dihydro-1H-inden-1-yl] octanoate is sourced from PubChem (CID 157305579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).