C29H42N2O9 — CID 163000686
[(2S,3R,7S,8S)-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-8-octyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate (PubChem CID 163000686) has the molecular formula C29H42N2O9 and a molecular weight of 562.66 g/mol. Its IUPAC name is [(2S,3R,7S,8S)-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-8-octyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate.
| Compound Name | [(2S,3R,7S,8S)-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-8-octyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
|---|---|
| PubChem CID | 163000686 |
| Molecular Formula | C29H42N2O9 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | [(2S,3R,7S,8S)-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-8-octyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
| SMILES | CCCCCCCC[C@@H]1C(=O)O[C@@H](C)[C@@H](NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C29H42N2O9/c1-5-7-8-9-10-11-14-21-26(40-23(33)13-6-2)19(4)39-29(37)24(18(3)38-28(21)36)31-27(35)20-15-12-16-22(25(20)34)30-17-32/h12,15-19,21,24,26,34H,5-11,13-14H2,1-4H3,(H,30,32)(H,31,35)/t18-,19?,21-,24+,26+/m0/s1 |
| InChIKey | ZAPRDHLWWAQCAI-JOJMQVNNSA-N |
| XLogP | 4.01 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|