C29H42N2O9 — CID 10437835
6-[3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]hexanoic acid (PubChem CID 10437835) has the molecular formula C29H42N2O9 and a molecular weight of 562.66 g/mol. Its IUPAC name is 6-[3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]hexanoic acid.
| Compound Name | 6-[3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 10437835 |
| Molecular Formula | C29H42N2O9 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 6-[3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]hexanoic acid |
| SMILES | CCCCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1CCCCCC(=O)O |
| InChI | InChI=1S/C29H42N2O9/c1-4-5-6-8-13-21-20(12-9-7-10-16-24(33)34)18(2)39-29(38)25(19(3)40-28(21)37)31-27(36)22-14-11-15-23(26(22)35)30-17-32/h11,14-15,17-21,25,35H,4-10,12-13,16H2,1-3H3,(H,30,32)(H,31,36)(H,33,34) |
| InChIKey | WHVNQTTYLLSEPW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|