C32H40N2O9 — CID 53381741
[(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-phenylmethoxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 53381741) has the molecular formula C32H40N2O9 and a molecular weight of 596.68 g/mol. Its IUPAC name is [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-phenylmethoxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-phenylmethoxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 53381741 |
| Molecular Formula | C32H40N2O9 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-phenylmethoxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(NC=O)c2OCc2ccccc2)C(=O)O[C@@H](C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C32H40N2O9/c1-6-7-14-24-27(43-30(37)19(2)3)21(5)42-32(39)26(20(4)41-31(24)38)34-29(36)23-15-11-16-25(33-18-35)28(23)40-17-22-12-9-8-10-13-22/h8-13,15-16,18-21,24,26-27H,6-7,14,17H2,1-5H3,(H,33,35)(H,34,36)/t20-,21+,24-,26+,27+/m1/s1 |
| InChIKey | CGRSEZCLXRGBGV-VPUMRVCOSA-N |
| XLogP | 4.18 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|