C28H40N2O9 — CID 162896065
[8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] heptanoate (PubChem CID 162896065) has the molecular formula C28H40N2O9 and a molecular weight of 548.63 g/mol. Its IUPAC name is [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] heptanoate.
| Compound Name | [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] heptanoate |
|---|---|
| PubChem CID | 162896065 |
| Molecular Formula | C28H40N2O9 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC1C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC(=O)C1CCCC |
| InChI | InChI=1S/C28H40N2O9/c1-5-7-9-10-15-22(32)39-25-18(4)38-28(36)23(17(3)37-27(35)20(25)12-8-6-2)30-26(34)19-13-11-14-21(24(19)33)29-16-31/h11,13-14,16-18,20,23,25,33H,5-10,12,15H2,1-4H3,(H,29,31)(H,30,34) |
| InChIKey | ANAKHOBOPPOGCQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|