C27H38N2O9 — CID 11570089
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-methoxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] propanoate (PubChem CID 11570089) has the molecular formula C27H38N2O9 and a molecular weight of 534.61 g/mol. Its IUPAC name is [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-methoxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] propanoate.
| Compound Name | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-methoxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] propanoate |
|---|---|
| PubChem CID | 11570089 |
| Molecular Formula | C27H38N2O9 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-methoxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] propanoate |
| SMILES | CCCCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(NC=O)c2OC)C(=O)O[C@@H](C)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C27H38N2O9/c1-6-8-9-10-12-19-23(38-21(31)7-2)17(4)37-27(34)22(16(3)36-26(19)33)29-25(32)18-13-11-14-20(28-15-30)24(18)35-5/h11,13-17,19,22-23H,6-10,12H2,1-5H3,(H,28,30)(H,29,32)/t16-,17+,19-,22+,23+/m1/s1 |
| InChIKey | FJJWRGHNVXXIRY-PFQKEVSBSA-N |
| XLogP | 3.15 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|