C14H16O2 — CID 145479052
(E)-3-(2,3-dihydro-1H-inden-2-yloxy)pent-3-en-2-one (PubChem CID 145479052) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1H-inden-2-yloxy)pent-3-en-2-one.
| Compound Name | (E)-3-(2,3-dihydro-1H-inden-2-yloxy)pent-3-en-2-one |
|---|---|
| PubChem CID | 145479052 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (E)-3-(2,3-dihydro-1H-inden-2-yloxy)pent-3-en-2-one |
| SMILES | C/C=C(/OC1Cc2ccccc2C1)C(C)=O |
| InChI | InChI=1S/C14H16O2/c1-3-14(10(2)15)16-13-8-11-6-4-5-7-12(11)9-13/h3-7,13H,8-9H2,1-2H3/b14-3+ |
| InChIKey | OGWIKMDXJLFRHG-LZWSPWQCSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|