C19H24O7 — CID 69087163
[(2R,4S,5S)-2-hydroxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate (PubChem CID 69087163) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is [(2R,4S,5S)-2-hydroxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate.
| Compound Name | [(2R,4S,5S)-2-hydroxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 69087163 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(2R,4S,5S)-2-hydroxy-4,6-dimethyl-5-(4-oxopentanoyloxy)oxan-3-yl] benzoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1C(C)O[C@@H](O)C(OC(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H24O7/c1-11(20)9-10-15(21)25-16-12(2)17(19(23)24-13(16)3)26-18(22)14-7-5-4-6-8-14/h4-8,12-13,16-17,19,23H,9-10H2,1-3H3/t12-,13?,16-,17?,19+/m0/s1 |
| InChIKey | NJIVVPAMNKZPBZ-OWQGAIDSSA-N |
| XLogP | 1.87 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |