C15H18N4O4 — CID 162288115
[(4S,5S)-2-hydroxy-4,5-dimethyl-6-(2H-tetrazol-5-yl)oxan-3-yl] benzoate (PubChem CID 162288115) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is [(4S,5S)-2-hydroxy-4,5-dimethyl-6-(2H-tetrazol-5-yl)oxan-3-yl] benzoate.
| Compound Name | [(4S,5S)-2-hydroxy-4,5-dimethyl-6-(2H-tetrazol-5-yl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 162288115 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(4S,5S)-2-hydroxy-4,5-dimethyl-6-(2H-tetrazol-5-yl)oxan-3-yl] benzoate |
| SMILES | C[C@@H]1C(c2nn[nH]n2)OC(O)C(OC(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C15H18N4O4/c1-8-9(2)12(23-14(20)10-6-4-3-5-7-10)15(21)22-11(8)13-16-18-19-17-13/h3-9,11-12,15,21H,1-2H3,(H,16,17,18,19)/t8-,9-,11?,12?,15?/m0/s1 |
| InChIKey | DCHIGVUBJDJXFJ-VPTQNTQFSA-N |
| XLogP | 1.09 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |