C25H28N2O6 — CID 72636863
(7,11-diacetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 72636863) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (7,11-diacetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | (7,11-diacetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 72636863 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (7,11-diacetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | CC(=O)OC1CC=CC(OC(C)=O)C(OC(=O)C=Cc2cn(C)cn2)Cc2ccccc2C1 |
| InChI | InChI=1S/C25H28N2O6/c1-17(28)31-22-9-6-10-23(32-18(2)29)24(14-20-8-5-4-7-19(20)13-22)33-25(30)12-11-21-15-27(3)16-26-21/h4-8,10-12,15-16,22-24H,9,13-14H2,1-3H3 |
| InChIKey | WTHXYQZISYKAMO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|