C12H16O2 — CID 18727347
(1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanediol (PubChem CID 18727347) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanediol.
| Compound Name | (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanediol |
|---|---|
| PubChem CID | 18727347 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanediol |
| SMILES | CC1c2ccccc2CCC1C(O)O |
| InChI | InChI=1S/C12H16O2/c1-8-10-5-3-2-4-9(10)6-7-11(8)12(13)14/h2-5,8,11-14H,6-7H2,1H3 |
| InChIKey | ROSQSRYBZDWVET-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|