C13H18O3 — CID 102396750
(1R,2R)-2-(dimethoxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 102396750) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1R,2R)-2-(dimethoxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-(dimethoxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102396750 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1R,2R)-2-(dimethoxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COC(OC)[C@@H]1CCc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C13H18O3/c1-15-13(16-2)11-8-7-9-5-3-4-6-10(9)12(11)14/h3-6,11-14H,7-8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | DNVHNSMSTUXEBH-NEPJUHHUSA-N |
| XLogP | 1.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|